EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O4 |
| Net Charge | 0 |
| Average Mass | 316.482 |
| Monoisotopic Mass | 316.26136 |
| SMILES | O=C(O)CCCCCCCCCCC(O)CCCCCCO |
| InChI | InChI=1S/C18H36O4/c19-16-12-8-7-10-14-17(20)13-9-5-3-1-2-4-6-11-15-18(21)22/h17,19-20H,1-16H2,(H,21,22) |
| InChIKey | ILQLNMYYQUJEBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,18-dihydroxyoctadecanoic acid (CHEBI:128770) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 12,18-dihydroxyoctadecanoic acid (CHEBI:128770) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 12,18-dihydroxyoctadecanoic acid (CHEBI:128770) is conjugate acid of 12,18-dihydroxyoctadecanoate (CHEBI:91294) |
| Incoming Relation(s) |
| 12,18-dihydroxyoctadecanoate (CHEBI:91294) is conjugate base of 12,18-dihydroxyoctadecanoic acid (CHEBI:128770) |
| IUPAC Name |
|---|
| 12,18-dihydroxyoctadecanoic acid |
| Synonym | Source |
|---|---|
| 12,18-dihydroxystearic acid | ChEBI |
| Citations |
|---|