EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O4S |
| Net Charge | 0 |
| Average Mass | 455.580 |
| Monoisotopic Mass | 455.18788 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(C)CC31CN(S(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C24H29N3O4S/c1-16-6-5-7-18(10-16)32(29,30)27-14-24(15-27)13-25(2)21(12-28)23-22(24)19-9-8-17(31-4)11-20(19)26(23)3/h5-11,21,28H,12-15H2,1-4H3/t21-/m0/s1 |
| InChIKey | ULPICNQPCCMLSF-NRFANRHFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-7-methoxy-2,9-dimethyl-1'-(3-methylphenyl)sulfonyl-1-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:128694) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40248 | LINCS |