EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N3O5S |
| Net Charge | 0 |
| Average Mass | 477.627 |
| Monoisotopic Mass | 477.22974 |
| SMILES | CCCC(=O)N1CC2(CCN(S(=O)(=O)CC)CC2)c2c(n(C)c3cc(OC)ccc23)[C@H]1CO |
| InChI | InChI=1S/C24H35N3O5S/c1-5-7-21(29)27-16-24(10-12-26(13-11-24)33(30,31)6-2)22-18-9-8-17(32-4)14-19(18)25(3)23(22)20(27)15-28/h8-9,14,20,28H,5-7,10-13,15-16H2,1-4H3/t20-/m1/s1 |
| InChIKey | MJMXLJSDDFUPOG-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-1'-ethylsulfonyl-1-(hydroxymethyl)-7-methoxy-9-methyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]-1-butanone (CHEBI:128527) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40081 | LINCS |