EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H14O11.2Na |
| Net Charge | 0 |
| Average Mass | 512.334 |
| Monoisotopic Mass | 512.03315 |
| SMILES | O=C([O-])c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)[O-])cc(=O)c34)cccc2o1.[Na+].[Na+] |
| InChI | InChI=1S/C23H16O11.2Na/c24-11(9-31-14-3-1-5-16-20(14)12(25)7-18(33-16)22(27)28)10-32-15-4-2-6-17-21(15)13(26)8-19(34-17)23(29)30;;/h1-8,11,24H,9-10H2,(H,27,28)(H,29,30);;/q;2*+1/p-2 |
| InChIKey | VLARUOGDXDTHEH-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anti-asthmatic agent Any compound that has anti-asthmatic effects. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-asthmatic drug A drug used to treat asthma. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disodium cromoglycate (CHEBI:128458) has part cromoglycate(2−) (CHEBI:59039) |
| disodium cromoglycate (CHEBI:128458) has role analgesic (CHEBI:35480) |
| disodium cromoglycate (CHEBI:128458) has role anti-asthmatic agent (CHEBI:65023) |
| disodium cromoglycate (CHEBI:128458) has role anti-asthmatic drug (CHEBI:49167) |
| disodium cromoglycate (CHEBI:128458) has role antineoplastic agent (CHEBI:35610) |
| disodium cromoglycate (CHEBI:128458) has role drug allergen (CHEBI:88188) |
| disodium cromoglycate (CHEBI:128458) has role ophthalmology drug (CHEBI:66981) |
| disodium cromoglycate (CHEBI:128458) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5,5'-[(2-hydroxypropane-1,3-diyl)bis(oxy)]bis(4-oxo-4H-chromene-2-carboxylate) |
| Synonyms | Source |
|---|---|
| Astilyn | ChEMBL |
| Cromoglicate sodium | ChEMBL |
| Cromoglycate disodium | ChemIDplus |
| cromolyn sodium | ChEMBL |
| Cromolyn sodium | KEGG DRUG |
| Dinatrium salz von 1,3-bis-(2-carboxychromon-5-yloxy)-2-hydroxypropan | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aerocrom | ChEMBL |
| Allercrom | ChEMBL |
| Aspire | ChEMBL |
| Brol-eze | ChEMBL |
| Catacrom | ChEMBL |
| Clariteyes | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00526 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3647577 | Beilstein |
| CAS:15826-37-6 | ChemIDplus |
| CAS:15826-37-6 | KEGG DRUG |
| Citations |
|---|