EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H14O11.2Na |
| Net Charge | 0 |
| Average Mass | 512.334 |
| Monoisotopic Mass | 512.03315 |
| SMILES | O=C([O-])c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)[O-])cc(=O)c34)cccc2o1.[Na+].[Na+] |
| InChI | InChI=1S/C23H16O11.2Na/c24-11(9-31-14-3-1-5-16-20(14)12(25)7-18(33-16)22(27)28)10-32-15-4-2-6-17-21(15)13(26)8-19(34-17)23(29)30;;/h1-8,11,24H,9-10H2,(H,27,28)(H,29,30);;/q;2*+1/p-2 |
| InChIKey | VLARUOGDXDTHEH-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disodium cromoglycate (CHEBI:128458) has part cromoglycate(2−) (CHEBI:59039) |
| disodium cromoglycate (CHEBI:128458) has role anti-asthmatic drug (CHEBI:49167) |
| disodium cromoglycate (CHEBI:128458) has role drug allergen (CHEBI:88188) |
| disodium cromoglycate (CHEBI:128458) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5,5'-[(2-hydroxypropane-1,3-diyl)bis(oxy)]bis(4-oxo-4H-chromene-2-carboxylate) |
| Synonyms | Source |
|---|---|
| Sodium salt of 5-[3-(2-carboxy-4-oxo-4H-5-chromenyloxy)-2-hydroxypropoxy]-4-oxo-4H-2-chromenecarboxylic acid | ChEMBL |
| disodium 5-{3-[(2-carboxylato-4-oxo-4H-chromen-5-yl)oxy]-2-hydroxypropoxy}-4-oxo-4H-chromene-2-carboxylate | ChEMBL |
| disodium cromoglycate | ChEMBL |
| disodium 5-[3-(2-carboxylato-4-oxo-4H-5-chromenyloxy)-2-hydroxypropoxy]-4-oxo-4H-2-chromenecarboxylate | ChEMBL |
| DSCG | ChEMBL |
| FPL-670 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00526 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3647577 | Beilstein |
| CAS:15826-37-6 | KEGG DRUG |
| CAS:15826-37-6 | ChemIDplus |
| Citations |
|---|