EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31FN4O3 |
| Net Charge | 0 |
| Average Mass | 466.557 |
| Monoisotopic Mass | 466.23802 |
| SMILES | CCCNC(=O)N1CC2(CN(Cc3cccc(F)c3)C2)c2c(nc3cc(OC)ccc23)[C@@H]1CO |
| InChI | InChI=1S/C26H31FN4O3/c1-3-9-28-25(33)31-16-26(14-30(15-26)12-17-5-4-6-18(27)10-17)23-20-8-7-19(34-2)11-21(20)29-24(23)22(31)13-32/h4-8,10-11,22,29,32H,3,9,12-16H2,1-2H3,(H,28,33)/t22-/m0/s1 |
| InChIKey | WLJAXZCEIQXDRN-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-1'-[(3-fluorophenyl)methyl]-1-(hydroxymethyl)-7-methoxy-N-propyl-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:128391) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39946 | LINCS |