EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28F2N4O4 |
| Net Charge | 0 |
| Average Mass | 498.530 |
| Monoisotopic Mass | 498.20786 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(C)=O)CC31CCN(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C26H28F2N4O4/c1-15(34)32-14-26(23-18-5-4-17(36-2)12-21(18)29-24(23)22(32)13-33)7-9-31(10-8-26)25(35)30-20-6-3-16(27)11-19(20)28/h3-6,11-12,22,29,33H,7-10,13-14H2,1-2H3,(H,30,35)/t22-/m1/s1 |
| InChIKey | GCLZSVQZAJNLBF-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-2-acetyl-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxy-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:128352) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39907 | LINCS |