EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29F2N3O2 |
| Net Charge | 0 |
| Average Mass | 441.522 |
| Monoisotopic Mass | 441.22278 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)NCC31CCN(Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C25H29F2N3O2/c1-29-22-12-18(32-2)4-5-19(22)23-24(29)21(14-31)28-15-25(23)7-9-30(10-8-25)13-16-11-17(26)3-6-20(16)27/h3-6,11-12,21,28,31H,7-10,13-15H2,1-2H3/t21-/m1/s1 |
| InChIKey | MMMDBRZAUZWGES-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-1'-[(2,5-difluorophenyl)methyl]-7-methoxy-9-methyl-1-spiro[2,3-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:128313) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39868 | LINCS |