EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35N5O3S |
| Net Charge | 0 |
| Average Mass | 497.665 |
| Monoisotopic Mass | 497.24606 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(=O)NC(C)C)CC31CCN(Cc2nccs2)CC1 |
| InChI | InChI=1S/C26H35N5O3S/c1-17(2)28-25(33)31-16-26(7-10-30(11-8-26)14-22-27-9-12-35-22)23-19-6-5-18(34-4)13-20(19)29(3)24(23)21(31)15-32/h5-6,9,12-13,17,21,32H,7-8,10-11,14-16H2,1-4H3,(H,28,33)/t21-/m1/s1 |
| InChIKey | PPRTXVLQEFGUPH-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1-(hydroxymethyl)-7-methoxy-9-methyl-N-propan-2-yl-1'-(2-thiazolylmethyl)-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:128156) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39711 | LINCS |