EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O4S2 |
| Net Charge | 0 |
| Average Mass | 419.528 |
| Monoisotopic Mass | 419.09735 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)NCC31CN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-26-12-4-5-13-14(7-12)21-18-15(8-23)20-9-19(17(13)18)10-22(11-19)28(24,25)16-3-2-6-27-16/h2-7,15,20-21,23H,8-11H2,1H3/t15-/m0/s1 |
| InChIKey | ZNHZAGOVNITORJ-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-7-methoxy-1'-thiophen-2-ylsulfonyl-1-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:127985) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39541 | LINCS |