EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30FN3O3 |
| Net Charge | 0 |
| Average Mass | 451.542 |
| Monoisotopic Mass | 451.22712 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(C(=O)c1ccc(F)cc1)CC31CCN(C)CC1 |
| InChI | InChI=1S/C26H30FN3O3/c1-28-12-10-26(11-13-28)16-30(25(32)17-4-6-18(27)7-5-17)22(15-31)24-23(26)20-9-8-19(33-3)14-21(20)29(24)2/h4-9,14,22,31H,10-13,15-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | PDOHSESDNKZOHO-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-fluorophenyl)-[(1R)-1-(hydroxymethyl)-7-methoxy-1',9-dimethyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanone (CHEBI:127826) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39382 | LINCS |