EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | O=C(O)CCC(=O)C1=CC=C[C@@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C11H12O6/c12-7(4-5-9(14)15)6-2-1-3-8(13)10(6)11(16)17/h1-3,8,10,13H,4-5H2,(H,14,15)(H,16,17)/t8-,10+/m1/s1 |
| InChIKey | QJYRAJSESKVEAE-SCZZXKLOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,6R)-2-succinyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CHEBI:1277) is a 2-succinyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CHEBI:11656) |
| (1S,6R)-2-succinyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CHEBI:1277) is conjugate acid of (1S,6R)-2-(3-carboxylatopropanoyl)-6-hydroxycyclohexa-2,4-diene-1-carboxylate(2−) (CHEBI:57272) |
| Incoming Relation(s) |
| (1S,6R)-2-(3-carboxylatopropanoyl)-6-hydroxycyclohexa-2,4-diene-1-carboxylate(2−) (CHEBI:57272) is conjugate base of (1S,6R)-2-succinyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CHEBI:1277) |
| IUPAC Name |
|---|
| (1S,6R)-2-(3-carboxypropanoyl)-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |