EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N4O4S |
| Net Charge | 0 |
| Average Mass | 510.660 |
| Monoisotopic Mass | 510.23008 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)C1CCOCC1)CC31CCN(Cc2nccs2)CC1 |
| InChI | InChI=1S/C27H34N4O4S/c1-34-19-2-3-20-21(14-19)29-25-22(16-32)31(26(33)18-4-11-35-12-5-18)17-27(24(20)25)6-9-30(10-7-27)15-23-28-8-13-36-23/h2-3,8,13-14,18,22,29,32H,4-7,9-12,15-17H2,1H3/t22-/m1/s1 |
| InChIKey | IAWRNXOODRNTQS-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-1-(hydroxymethyl)-7-methoxy-1'-(2-thiazolylmethyl)-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]-(4-oxanyl)methanone (CHEBI:127661) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39218 | LINCS |