EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O3 |
| Net Charge | 0 |
| Average Mass | 390.608 |
| Monoisotopic Mass | 390.31340 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C25H42O3/c26-24-21-19-23(20-22-24)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-25(27)28/h19-22,26H,1-18H2,(H,27,28) |
| InChIKey | IJOZORVJRYYXLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-(4-hydroxyphenyl)nonadecanoic acid (CHEBI:127547) is a monocarboxylic acid (CHEBI:25384) |
| 19-(4-hydroxyphenyl)nonadecanoic acid (CHEBI:127547) is a phenols (CHEBI:33853) |
| 19-(4-hydroxyphenyl)nonadecanoic acid (CHEBI:127547) is conjugate acid of 19-(4-hydroxyphenyl)nonadecanoate (CHEBI:91236) |
| Incoming Relation(s) |
| 19-(4-hydroxyphenyl)nonadecanoyl-AMP (CHEBI:128120) has functional parent 19-(4-hydroxyphenyl)nonadecanoic acid (CHEBI:127547) |
| 19-(4-hydroxyphenyl)nonadecanoate (CHEBI:91236) is conjugate base of 19-(4-hydroxyphenyl)nonadecanoic acid (CHEBI:127547) |
| IUPAC Name |
|---|
| 19-(4-hydroxyphenyl)nonadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-18657 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19953721 | Reaxys |