EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32FN5O6 |
| Net Charge | 0 |
| Average Mass | 601.635 |
| Monoisotopic Mass | 601.23366 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(C(=O)Nc1ccc(F)cc1)CC31CCN(C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C32H32FN5O6/c1-42-22-7-8-23-24(15-22)36-29-25(16-39)38(31(41)34-20-4-2-19(33)3-5-20)17-32(28(23)29)10-12-37(13-11-32)30(40)35-21-6-9-26-27(14-21)44-18-43-26/h2-9,14-15,25,36,39H,10-13,16-18H2,1H3,(H,34,41)(H,35,40)/t25-/m0/s1 |
| InChIKey | HCNINEWJUWGNRJ-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-N1'-(1,3-benzodioxol-5-yl)-N2-(4-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]-1',2-dicarboxamide (CHEBI:127460) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39018 | LINCS |