EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36FN5O4 |
| Net Charge | 0 |
| Average Mass | 537.636 |
| Monoisotopic Mass | 537.27513 |
| SMILES | CCCNC(=O)N1CC2(CCN(C(=O)Nc3cccc(F)c3)CC2)c2c(n(C)c3cc(OC)ccc23)[C@@H]1CO |
| InChI | InChI=1S/C29H36FN5O4/c1-4-12-31-27(37)35-18-29(10-13-34(14-11-29)28(38)32-20-7-5-6-19(30)15-20)25-22-9-8-21(39-3)16-23(22)33(2)26(25)24(35)17-36/h5-9,15-16,24,36H,4,10-14,17-18H2,1-3H3,(H,31,37)(H,32,38)/t24-/m0/s1 |
| InChIKey | SVIBUUHZBFMTOL-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-N1'-(3-fluorophenyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-N2-propylspiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]-1',2-dicarboxamide (CHEBI:127450) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-39008 | LINCS |