EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N3O4 |
| Net Charge | 0 |
| Average Mass | 413.518 |
| Monoisotopic Mass | 413.23146 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)NCC31CCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C23H31N3O4/c1-29-16-2-3-17-18(12-16)25-21-19(13-27)24-14-23(20(17)21)6-8-26(9-7-23)22(28)15-4-10-30-11-5-15/h2-3,12,15,19,24-25,27H,4-11,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | QCPCXFRNGVFKGK-IBGZPJMESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-1-(hydroxymethyl)-7-methoxy-1'-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]yl]-(4-oxanyl)methanone (CHEBI:127346) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38904 | LINCS |