EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O3 |
| Net Charge | 0 |
| Average Mass | 362.554 |
| Monoisotopic Mass | 362.28210 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C23H38O3/c24-22-19-17-21(18-20-22)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-23(25)26/h17-20,24H,1-16H2,(H,25,26) |
| InChIKey | KGNHPHVILCBASG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-(4-hydroxyphenyl)heptadecanoic acid (CHEBI:127343) is a monocarboxylic acid (CHEBI:25384) |
| 17-(4-hydroxyphenyl)heptadecanoic acid (CHEBI:127343) is a phenols (CHEBI:33853) |
| 17-(4-hydroxyphenyl)heptadecanoic acid (CHEBI:127343) is conjugate acid of 17-(4-hydroxyphenyl)heptadecanoate (CHEBI:91233) |
| Incoming Relation(s) |
| 17-(4-hydroxyphenyl)heptadecanoyl-AMP (CHEBI:127781) has functional parent 17-(4-hydroxyphenyl)heptadecanoic acid (CHEBI:127343) |
| 17-(4-hydroxyphenyl)heptadecanoate (CHEBI:91233) is conjugate base of 17-(4-hydroxyphenyl)heptadecanoic acid (CHEBI:127343) |
| IUPAC Name |
|---|
| 17-(4-hydroxyphenyl)heptadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-18623 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19953719 | Reaxys |
| Citations |
|---|