EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H33FN4O4 |
| Net Charge | 0 |
| Average Mass | 556.638 |
| Monoisotopic Mass | 556.24858 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)Cc1ccccc1)CC31CCN(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C32H33FN4O4/c1-41-22-11-12-23-26(18-22)34-30-27(19-38)37(28(39)17-21-7-3-2-4-8-21)20-32(29(23)30)13-15-36(16-14-32)31(40)35-25-10-6-5-9-24(25)33/h2-12,18,27,34,38H,13-17,19-20H2,1H3,(H,35,40)/t27-/m1/s1 |
| InChIKey | UMKWVNJRYUYNAG-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-N-(2-fluorophenyl)-1-(hydroxymethyl)-7-methoxy-2-(1-oxo-2-phenylethyl)-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:127321) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38880 | LINCS |