EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32FN3O6S |
| Net Charge | 0 |
| Average Mass | 581.666 |
| Monoisotopic Mass | 581.19958 |
| SMILES | COc1cc(CN2CC3(CN(S(=O)(=O)c4cccc(F)c4)C3)c3c(nc4cc(OC)ccc34)[C@@H]2CO)cc(OC)c1 |
| InChI | InChI=1S/C30H32FN3O6S/c1-38-21-7-8-25-26(13-21)32-29-27(15-35)33(14-19-9-22(39-2)12-23(10-19)40-3)16-30(28(25)29)17-34(18-30)41(36,37)24-6-4-5-20(31)11-24/h4-13,27,32,35H,14-18H2,1-3H3/t27-/m0/s1 |
| InChIKey | PJTCBMBXODRCAF-MHZLTWQESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-2-[(3,5-dimethoxyphenyl)methyl]-1'-(3-fluorophenyl)sulfonyl-7-methoxy-1-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:127317) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38876 | LINCS |