EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37N3O6S2 |
| Net Charge | 0 |
| Average Mass | 623.797 |
| Monoisotopic Mass | 623.21238 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(S(=O)(=O)c1ccc(C)cc1)CC31CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C32H37N3O6S2/c1-22-5-10-25(11-6-22)42(37,38)34-17-15-32(16-18-34)21-35(43(39,40)26-12-7-23(2)8-13-26)29(20-36)31-30(32)27-14-9-24(41-4)19-28(27)33(31)3/h5-14,19,29,36H,15-18,20-21H2,1-4H3/t29-/m1/s1 |
| InChIKey | PSCJGMROHWESOF-GDLZYMKVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-7-methoxy-9-methyl-1',2-bis-(4-methylphenyl)sulfonyl-1-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:127303) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38863 | LINCS |