EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36FN3O4 |
| Net Charge | 0 |
| Average Mass | 521.633 |
| Monoisotopic Mass | 521.26898 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)C1CCOCC1)CC31CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C30H36FN3O4/c1-37-23-5-6-24-25(16-23)32-28-26(18-35)34(29(36)21-7-13-38-14-8-21)19-30(27(24)28)9-11-33(12-10-30)17-20-3-2-4-22(31)15-20/h2-6,15-16,21,26,32,35H,7-14,17-19H2,1H3/t26-/m1/s1 |
| InChIKey | IWQQPQHTVOLVIH-AREMUKBSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-1'-[(3-fluorophenyl)methyl]-1-(hydroxymethyl)-7-methoxy-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]-(4-oxanyl)methanone (CHEBI:127280) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38840 | LINCS |