EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N4O3 |
| Net Charge | 0 |
| Average Mass | 480.653 |
| Monoisotopic Mass | 480.31004 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(CC1CC1)CC31CCN(C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C28H40N4O3/c1-30-23-15-21(35-2)9-10-22(23)25-26(30)24(17-33)32(16-19-7-8-19)18-28(25)11-13-31(14-12-28)27(34)29-20-5-3-4-6-20/h9-10,15,19-20,24,33H,3-8,11-14,16-18H2,1-2H3,(H,29,34)/t24-/m0/s1 |
| InChIKey | BPYKPCIEMBPLBA-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-N-cyclopentyl-2-(cyclopropylmethyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:127275) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38835 | LINCS |