EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | COc1ccc(C[C@@H](N)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C12H17NO3/c1-7-8(2)11(16-3)5-4-9(7)6-10(13)12(14)15/h4-5,10H,6,13H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | XOXKSLGPWZNSBO-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-O,2,3-trimethyltyrosine (CHEBI:127151) is a O,2,3-trimethyltyrosine (CHEBI:90142) |
| D-O,2,3-trimethyltyrosine (CHEBI:127151) is a D-tyrosine derivative (CHEBI:84124) |
| D-O,2,3-trimethyltyrosine (CHEBI:127151) is enantiomer of L-O,2,3-trimethyltyrosine (CHEBI:127106) |
| Incoming Relation(s) |
| DL-O,2,3-trimethyltyrosine (CHEBI:127177) has part D-O,2,3-trimethyltyrosine (CHEBI:127151) |
| L-O,2,3-trimethyltyrosine (CHEBI:127106) is enantiomer of D-O,2,3-trimethyltyrosine (CHEBI:127151) |
| IUPAC Name |
|---|
| O,2,3-trimethyl-D-tyrosine |
| Synonym | Source |
|---|---|
| (2R)-2-amino-3-(4-methoxy-2,3-dimethylphenyl)propanoic acid | IUPAC |