EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O4S |
| Net Charge | 0 |
| Average Mass | 393.509 |
| Monoisotopic Mass | 393.17223 |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)CN[C@@H](CO)c1nc3cc(OC)ccc3c12 |
| InChI | InChI=1S/C19H27N3O4S/c1-3-27(24,25)22-8-6-19(7-9-22)12-20-16(11-23)18-17(19)14-5-4-13(26-2)10-15(14)21-18/h4-5,10,16,20-21,23H,3,6-9,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | FUGMCAUAETXRSX-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-1'-ethylsulfonyl-7-methoxy-1-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:127088) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38651 | LINCS |