EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39N5O6 |
| Net Charge | 0 |
| Average Mass | 577.682 |
| Monoisotopic Mass | 577.29003 |
| SMILES | COc1ccc(NC(=O)N2CCC3(CC2)CN(C(=O)CN2CCOCC2)[C@H](CO)c2nc4cc(OC)ccc4c23)cc1 |
| InChI | InChI=1S/C31H39N5O6/c1-40-22-5-3-21(4-6-22)32-30(39)35-11-9-31(10-12-35)20-36(27(38)18-34-13-15-42-16-14-34)26(19-37)29-28(31)24-8-7-23(41-2)17-25(24)33-29/h3-8,17,26,33,37H,9-16,18-20H2,1-2H3,(H,32,39)/t26-/m1/s1 |
| InChIKey | HFGJOCYUVOTFPL-AREMUKBSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1-(hydroxymethyl)-7-methoxy-N-(4-methoxyphenyl)-2-[2-(4-morpholinyl)-1-oxoethyl]-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:127084) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38647 | LINCS |