EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O4 |
| Net Charge | 0 |
| Average Mass | 371.437 |
| Monoisotopic Mass | 371.18451 |
| SMILES | CCC(=O)N1CC2(CN(C(C)=O)C2)c2c(nc3cc(OC)ccc23)[C@@H]1CO |
| InChI | InChI=1S/C20H25N3O4/c1-4-17(26)23-11-20(9-22(10-20)12(2)25)18-14-6-5-13(27-3)7-15(14)21-19(18)16(23)8-24/h5-7,16,21,24H,4,8-11H2,1-3H3/t16-/m0/s1 |
| InChIKey | SIOVSAKWBBHVEW-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1R)-1'-acetyl-1-(hydroxymethyl)-7-methoxy-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]-1-propanone (CHEBI:127049) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38612 | LINCS |