EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N4O5 |
| Net Charge | 0 |
| Average Mass | 436.468 |
| Monoisotopic Mass | 436.17467 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)NCC31CN(C(=O)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C23H24N4O5/c1-30-14-3-4-15-16(7-14)26-21-17(8-28)24-9-23(20(15)21)10-27(11-23)22(29)25-13-2-5-18-19(6-13)32-12-31-18/h2-7,17,24,26,28H,8-12H2,1H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | VIJMTLJWVSNMKE-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-N-(1,3-benzodioxol-5-yl)-1-(hydroxymethyl)-7-methoxy-1'-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:126820) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38383 | LINCS |