EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31N3O6S |
| Net Charge | 0 |
| Average Mass | 513.616 |
| Monoisotopic Mass | 513.19336 |
| SMILES | CCS(=O)(=O)N1CC2(CN(Cc3ccc4c(c3)OCO4)[C@@H](CO)c3c2c2ccc(OC)cc2n3C)C1 |
| InChI | InChI=1S/C26H31N3O6S/c1-4-36(31,32)29-14-26(15-29)13-28(11-17-5-8-22-23(9-17)35-16-34-22)21(12-30)25-24(26)19-7-6-18(33-3)10-20(19)27(25)2/h5-10,21,30H,4,11-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | PXYBFBFRDGPFAL-NRFANRHFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-2-(1,3-benzodioxol-5-ylmethyl)-1'-ethylsulfonyl-7-methoxy-9-methyl-1-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:126815) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38378 | LINCS |