EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N4O3 |
| Net Charge | 0 |
| Average Mass | 474.605 |
| Monoisotopic Mass | 474.26309 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(C(=O)c1ccncc1)CC31CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C28H34N4O3/c1-30-23-15-21(35-2)5-6-22(23)25-26(30)24(17-33)32(27(34)20-7-11-29-12-8-20)18-28(25)9-13-31(14-10-28)16-19-3-4-19/h5-8,11-12,15,19,24,33H,3-4,9-10,13-14,16-18H2,1-2H3/t24-/m0/s1 |
| InChIKey | MGDQFVBQSWCYMZ-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-1'-(cyclopropylmethyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]-pyridin-4-ylmethanone (CHEBI:126796) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38359 | LINCS |