EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N4O4 |
| Net Charge | 0 |
| Average Mass | 460.534 |
| Monoisotopic Mass | 460.21106 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)C1CCC1)CC31CN(C(=O)c2ccccn2)C1 |
| InChI | InChI=1S/C26H28N4O4/c1-34-17-8-9-18-20(11-17)28-23-21(12-31)30(24(32)16-5-4-6-16)15-26(22(18)23)13-29(14-26)25(33)19-7-2-3-10-27-19/h2-3,7-11,16,21,28,31H,4-6,12-15H2,1H3/t21-/m1/s1 |
| InChIKey | DNTRTSDMDMDTCA-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclobutyl-[(1S)-1-(hydroxymethyl)-7-methoxy-1'-[oxo(2-pyridinyl)methyl]-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]methanone (CHEBI:126794) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38357 | LINCS |