EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34FN3O3 |
| Net Charge | 0 |
| Average Mass | 491.607 |
| Monoisotopic Mass | 491.25842 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(C(=O)C1CC1)CC31CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C29H34FN3O3/c1-31-24-15-22(36-2)8-9-23(24)26-27(31)25(17-34)33(28(35)20-6-7-20)18-29(26)10-12-32(13-11-29)16-19-4-3-5-21(30)14-19/h3-5,8-9,14-15,20,25,34H,6-7,10-13,16-18H2,1-2H3/t25-/m0/s1 |
| InChIKey | JYNWHADBVHDRHI-VWLOTQADSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclopropyl-[(1R)-1'-[(3-fluorophenyl)methyl]-1-(hydroxymethyl)-7-methoxy-9-methyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanone (CHEBI:126789) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38352 | LINCS |