EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33F2N3O4 |
| Net Charge | 0 |
| Average Mass | 513.585 |
| Monoisotopic Mass | 513.24391 |
| SMILES | COCC(=O)N1CCC2(CC1)CN(Cc1cc(F)ccc1F)[C@@H](CO)c1c2c2ccc(OC)cc2n1C |
| InChI | InChI=1S/C28H33F2N3O4/c1-31-23-13-20(37-3)5-6-21(23)26-27(31)24(15-34)33(14-18-12-19(29)4-7-22(18)30)17-28(26)8-10-32(11-9-28)25(35)16-36-2/h4-7,12-13,24,34H,8-11,14-17H2,1-3H3/t24-/m0/s1 |
| InChIKey | CEMVEAYQMYWLTK-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1R)-2-[(2,5-difluorophenyl)methyl]-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]-2-methoxyethanone (CHEBI:126774) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38337 | LINCS |