EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N4O3 |
| Net Charge | 0 |
| Average Mass | 420.513 |
| Monoisotopic Mass | 420.21614 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)NCC31CCN(C(=O)Cc2cccnc2)CC1 |
| InChI | InChI=1S/C24H28N4O3/c1-31-17-4-5-18-19(12-17)27-23-20(14-29)26-15-24(22(18)23)6-9-28(10-7-24)21(30)11-16-3-2-8-25-13-16/h2-5,8,12-13,20,26-27,29H,6-7,9-11,14-15H2,1H3/t20-/m0/s1 |
| InChIKey | NZUADFBIDGBVNA-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1R)-1-(hydroxymethyl)-7-methoxy-1'-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]yl]-2-(3-pyridinyl)ethanone (CHEBI:126726) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38289 | LINCS |