EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N4O4 |
| Net Charge | 0 |
| Average Mass | 482.625 |
| Monoisotopic Mass | 482.28931 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(C(=O)NC(C)C)CC31CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C27H38N4O4/c1-17(2)28-26(34)31-16-27(10-12-30(13-11-27)25(33)18-6-4-5-7-18)23-20-9-8-19(35-3)14-21(20)29-24(23)22(31)15-32/h8-9,14,17-18,22,29,32H,4-7,10-13,15-16H2,1-3H3,(H,28,34)/t22-/m0/s1 |
| InChIKey | BDHHGJUFFFJCPO-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-1'-[cyclopentyl(oxo)methyl]-1-(hydroxymethyl)-7-methoxy-N-propan-2-yl-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:126686) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38249 | LINCS |