EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O3S |
| Net Charge | 0 |
| Average Mass | 412.555 |
| Monoisotopic Mass | 412.18206 |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(/C=C/c2nc(C3CCC3)cs2)c1)C(=O)O |
| InChI | InChI=1S/C23H28N2O3S/c1-3-23(4-2,22(27)28)14-20(26)24-18-10-5-7-16(13-18)11-12-21-25-19(15-29-21)17-8-6-9-17/h5,7,10-13,15,17H,3-4,6,8-9,14H2,1-2H3,(H,24,26)(H,27,28)/b12-11+ |
| InChIKey | BZMKNPGKXJAIDV-VAWYXSNFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| Applications: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinalukast (CHEBI:126598) has role anti-arrhythmia drug (CHEBI:38070) |
| cinalukast (CHEBI:126598) has role anti-asthmatic drug (CHEBI:49167) |
| cinalukast (CHEBI:126598) has role leukotriene antagonist (CHEBI:49159) |
| cinalukast (CHEBI:126598) is a 1,3-thiazoles (CHEBI:38418) |
| cinalukast (CHEBI:126598) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 4-({3-[(E)-2-(4-cyclobutyl-1,3-thiazol-2-yl)ethenyl]phenyl}amino)-2,2-diethyl-4-oxobutanoic acid |
| INN | Source |
|---|---|
| cinalukast | ChemIDplus |
| Synonym | Source |
|---|---|
| 3'-((E)-2-(4-cyclobutyl-2-thiazolyl)vinyl)-2,2-diethylsuccinanilic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:128312-51-6 | ChemIDplus |