EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N5O5S |
| Net Charge | 0 |
| Average Mass | 485.566 |
| Monoisotopic Mass | 485.17329 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(C(=O)c1cnccn1)CC31CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C23H27N5O5S/c1-33-15-3-4-16-17(11-15)26-21-19(13-29)28(22(30)18-12-24-7-8-25-18)14-23(20(16)21)5-9-27(10-6-23)34(2,31)32/h3-4,7-8,11-12,19,26,29H,5-6,9-10,13-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | CJZRHNNVPHEALW-IBGZPJMESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-1-(hydroxymethyl)-7-methoxy-1'-methylsulfonyl-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]-(2-pyrazinyl)methanone (CHEBI:126482) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-38046 | LINCS |