EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | C[N+](C)(C)[C@@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H17NO3/c1-13(2,3)11(12(15)16)8-9-4-6-10(14)7-5-9/h4-7,11H,8H2,1-3H3,(H-,14,15,16)/t11-/m0/s1 |
| InChIKey | KDVBLCRQNNLSIV-NSHDSACASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosine betaine (CHEBI:126352) is a L-tyrosine derivative (CHEBI:27177) |
| L-tyrosine betaine (CHEBI:126352) is a tyrosine betaine (CHEBI:90141) |
| L-tyrosine betaine (CHEBI:126352) is enantiomer of D-tyrosine betaine (CHEBI:126432) |
| Incoming Relation(s) |
| DL-tyrosine betaine (CHEBI:126599) has part L-tyrosine betaine (CHEBI:126352) |
| D-tyrosine betaine (CHEBI:126432) is enantiomer of L-tyrosine betaine (CHEBI:126352) |
| IUPAC Name |
|---|
| (2S)-3-(4-hydroxyphenyl)-2-(trimethylazaniumyl)propanoate |
| Synonyms | Source |
|---|---|
| L-N,N,N-trimethyltyrosine | ChEBI |
| N,N,N-trimethyl-L-tyrosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3908856 | Reaxys |