EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33N5O4 |
| Net Charge | 0 |
| Average Mass | 479.581 |
| Monoisotopic Mass | 479.25325 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(=O)Nc1c(C)noc1C)CC31CN(CC2CC2)C1 |
| InChI | InChI=1S/C26H33N5O4/c1-15-23(16(2)35-28-15)27-25(33)31-14-26(12-30(13-26)10-17-5-6-17)22-19-8-7-18(34-4)9-20(19)29(3)24(22)21(31)11-32/h7-9,17,21,32H,5-6,10-14H2,1-4H3,(H,27,33)/t21-/m1/s1 |
| InChIKey | XKSIWSGTCPACLT-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1'-(cyclopropylmethyl)-N-(3,5-dimethyl-4-isoxazolyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:126161) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-37728 | LINCS |