EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N4O4 |
| Net Charge | 0 |
| Average Mass | 428.533 |
| Monoisotopic Mass | 428.24236 |
| SMILES | CCCC(=O)N1CC2(CN(C(=O)NC(C)C)C2)c2c(nc3cc(OC)ccc23)[C@H]1CO |
| InChI | InChI=1S/C23H32N4O4/c1-5-6-19(29)27-13-23(11-26(12-23)22(30)24-14(2)3)20-16-8-7-15(31-4)9-17(16)25-21(20)18(27)10-28/h7-9,14,18,25,28H,5-6,10-13H2,1-4H3,(H,24,30)/t18-/m1/s1 |
| InChIKey | QJIONCXBIFUOGD-GOSISDBHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1-(hydroxymethyl)-7-methoxy-2-(1-oxobutyl)-N-propan-2-yl-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:125900) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-37467 | LINCS |