EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12NO4 |
| Net Charge | -1 |
| Average Mass | 270.264 |
| Monoisotopic Mass | 270.07718 |
| SMILES | COc1ccc(C(=O)[O-])c(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H13NO4/c1-20-11-7-8-12(15(18)19)13(9-11)16-14(17)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17)(H,18,19)/p-1 |
| InChIKey | NZSBJWOTLHVBNU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-4-methoxyanthranilate (CHEBI:36564) has functional parent anthranilate (CHEBI:16567) |
| N-benzoyl-4-methoxyanthranilate (CHEBI:36564) is a amidobenzoate (CHEBI:61666) |
| N-benzoyl-4-methoxyanthranilate (CHEBI:36564) is a methoxybenzoate (CHEBI:25236) |
| N-benzoyl-4-methoxyanthranilate (CHEBI:36564) is conjugate base of N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) |
| Incoming Relation(s) |
| N-benzoyl-4-methoxyanthranilic acid (CHEBI:28609) is conjugate acid of N-benzoyl-4-methoxyanthranilate (CHEBI:36564) |
| IUPAC Name |
|---|
| 2-benzamido-4-methoxybenzoate |
| Synonym | Source |
|---|---|
| 2-(benzoylamino)-4-methoxybenzoate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-benzoyl-4-methoxyanthranilate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04208 | KEGG COMPOUND |