EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2 |
| Net Charge | 0 |
| Average Mass | 174.247 |
| Monoisotopic Mass | 174.11570 |
| SMILES | Cc1ccc2ncc(CCN)c2c1 |
| InChI | InChI=1S/C11H14N2/c1-8-2-3-11-10(6-8)9(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | PYOUAIQXJALPKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypsizygus marmoreus (ncbitaxon:39966) | mycelium (BTO:0001436) | PubMed (36558049) | |
| Inonotus obliquus (ncbitaxon:167356) | - | PubMed (37446570) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Application: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyltryptamine (CHEBI:125675) has role fungal metabolite (CHEBI:76946) |
| 5-methyltryptamine (CHEBI:125675) has role serotonergic agonist (CHEBI:35941) |
| 5-methyltryptamine (CHEBI:125675) is a methylindole (CHEBI:38460) |
| 5-methyltryptamine (CHEBI:125675) is a primary amino compound (CHEBI:50994) |
| 5-methyltryptamine (CHEBI:125675) is a tryptamines (CHEBI:27162) |
| 5-methyltryptamine (CHEBI:125675) is conjugate base of 5-methyltryptaminium (CHEBI:229642) |
| Incoming Relation(s) |
| 5-methyltryptaminium (CHEBI:229642) is conjugate acid of 5-methyltryptamine (CHEBI:125675) |
| IUPAC Name |
|---|
| 2-(5-methyl-1H-indol-3-yl)ethanamine |
| Synonyms | Source |
|---|---|
| 2-(5-methyl-1H-indol-3-yl)ethan-1-amine | IUPAC |
| 2-(5-methyl-1H-indol-3-yl)ethylamine | ChEBI |
| 5-methyl-1H-indole-3-ethanamine | ChEBI |
| Citations |
|---|