EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NO3S |
| Net Charge | 0 |
| Average Mass | 147.155 |
| Monoisotopic Mass | 146.99901 |
| SMILES | O=C1N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C4H5NO3S/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 |
| InChIKey | BMLMGCPTLHPWPY-REOHCLBHSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-2-oxo-4-thiazolidinecarboxylic acid (CHEBI:125673) has functional parent α-amino acid (CHEBI:33704) |
| (4R)-2-oxo-4-thiazolidinecarboxylic acid (CHEBI:125673) has role anti-HIV agent (CHEBI:64946) |
| (4R)-2-oxo-4-thiazolidinecarboxylic acid (CHEBI:125673) is a organonitrogen compound (CHEBI:35352) |
| (4R)-2-oxo-4-thiazolidinecarboxylic acid (CHEBI:125673) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Koprosteine | ChEMBL |
| L-2-oxo-4-thiazolidinecarboxylic acid | ChEMBL |
| Oxothiazolidinecarboxylic acid | ChEMBL |
| procysteine | ChEMBL |
| Procysteine | ChEMBL |
| Brand Name | Source |
|---|---|
| L-2-oxothiazolidine-4-carboxylic acid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-37240 | LINCS |
| Citations |
|---|