EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N4O2S3 |
| Net Charge | 0 |
| Average Mass | 466.613 |
| Monoisotopic Mass | 466.05919 |
| SMILES | Cc1ccc2nc(NC(=O)CSc3nc4c(c(=O)n3-c3ccccc3)SCC4)sc2c1 |
| InChI | InChI=1S/C22H18N4O2S3/c1-13-7-8-15-17(11-13)31-21(23-15)25-18(27)12-30-22-24-16-9-10-29-19(16)20(28)26(22)14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H,23,25,27) |
| InChIKey | WRKPZSMRWPJJDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IWP-2 (CHEBI:125649) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| IWP-2 (CHEBI:125649) has role Wnt signalling inhibitor (CHEBI:78031) |
| IWP-2 (CHEBI:125649) is a benzenes (CHEBI:22712) |
| IWP-2 (CHEBI:125649) is a benzothiazoles (CHEBI:37947) |
| IWP-2 (CHEBI:125649) is a organic sulfide (CHEBI:16385) |
| IWP-2 (CHEBI:125649) is a secondary carboxamide (CHEBI:140325) |
| IWP-2 (CHEBI:125649) is a thienopyridine (CHEBI:37942) |
| IUPAC Name |
|---|
| N-(6-methyl-1,3-benzothiazol-2-yl)-2-[(4-oxo-3-phenyl-3,4,6,7-tetrahydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]acetamide |
| Synonyms | Source |
|---|---|
| N-(6-methylbenzo[d]thiazol-2-yl)-2-(4-oxo-3-phenyl-3,4,6,7-tetrahydrothieno[3,2-d]pyrimidin-2-ylthio)acetamide | ChEBI |
| IWP 2 | ChEBI |
| IWP2 | ChEBI |
| Citations |
|---|