EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | NCCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C8H11NO3/c9-4-3-5-1-2-6(10)8(12)7(5)11/h1-2,10-12H,3-4,9H2 |
| InChIKey | WYYIHCWISNZQQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-aminoethyl)benzene-1,2,3-triol (CHEBI:125591) is a catecholamine (CHEBI:33567) |
| Manual Xrefs | Databases |
|---|---|
| LSM-37133 | LINCS |