EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N3O3 |
| Net Charge | 0 |
| Average Mass | 307.394 |
| Monoisotopic Mass | 307.18959 |
| SMILES | CN(C)c1ccc(C(=O)NCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H25N3O3/c1-19(2)14-10-8-13(9-11-14)16(21)17-12-6-4-3-5-7-15(20)18-22/h8-11,22H,3-7,12H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | MXWDSZWTBOCWBK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) has role antineoplastic agent (CHEBI:35610) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) has role apoptosis inducer (CHEBI:68495) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) is a benzamides (CHEBI:22702) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) is a hydroxamic acid (CHEBI:24650) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) is a secondary carboxamide (CHEBI:140325) |
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (CHEBI:125562) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| Synonyms | Source |
|---|---|
| 4-dimethylamino-N-(6-hydroxycarbamoylhexyl)benzamide | ChEBI |
| M-344 | LINCS |
| M344 | ChEBI |
| D237 | ChEBI |
| N-hydroxy-7-(4-dimethylaminobenzoyl)aminoheptanamide | ChEBI |
| histone deacetylase inhibitor III | ChEBI |
| Citations |
|---|