EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO4 |
| Net Charge | 0 |
| Average Mass | 173.168 |
| Monoisotopic Mass | 173.06881 |
| SMILES | C[C@@](N)(C(=O)O)[C@H]1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C7H11NO4/c1-7(8,6(11)12)4-2-3(4)5(9)10/h3-4H,2,8H2,1H3,(H,9,10)(H,11,12)/t3-,4-,7-/m0/s1 |
| InChIKey | KFACHLANPCGTFI-FVSJBQLASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2S)-2-[(1S)-1-amino-1-carboxyethyl]-1-cyclopropanecarboxylic acid (CHEBI:125551) is a D-α-amino acid (CHEBI:16733) |
| Manual Xrefs | Databases |
|---|---|
| LSM-37073 | LINCS |