EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N4O2 |
| Net Charge | 0 |
| Average Mass | 458.606 |
| Monoisotopic Mass | 458.26818 |
| SMILES | Nc1ccc(CCNC(=O)[C@H]2[C@H]3C[C@H]4c5nc6ccccc6c5CCN4C[C@H]3CC[C@@H]2O)cc1 |
| InChI | InChI=1S/C28H34N4O2/c29-19-8-5-17(6-9-19)11-13-30-28(34)26-22-15-24-27-21(20-3-1-2-4-23(20)31-27)12-14-32(24)16-18(22)7-10-25(26)33/h1-6,8-9,18,22,24-26,31,33H,7,10-16,29H2,(H,30,34)/t18-,22+,24+,25+,26+/m1/s1 |
| InChIKey | LIYGLGZKJWIQDC-XYCLDAKMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,15S,18S,19S,20S)-N-[2-(4-aminophenyl)ethyl]-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide (CHEBI:125538) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| LSM-37053 | LINCS |