EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31ClN4O5 |
| Net Charge | 0 |
| Average Mass | 587.076 |
| Monoisotopic Mass | 586.19830 |
| SMILES | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)C3CC4CC(C3)CC2C4)nn1-c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C32H31ClN4O5/c1-41-27-4-3-5-28(42-2)29(27)26-16-24(36-37(26)25-8-9-34-23-15-21(33)6-7-22(23)25)30(38)35-32(31(39)40)19-11-17-10-18(13-19)14-20(32)12-17/h3-9,15-20H,10-14H2,1-2H3,(H,35,38)(H,39,40) |
| InChIKey | DYLJVOXRWLXDIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[[1-(7-chloro-4-quinolinyl)-5-(2,6-dimethoxyphenyl)-3-pyrazolyl]-oxomethyl]amino]-2-adamantanecarboxylic acid (CHEBI:125516) has role antineoplastic agent (CHEBI:35610) |
| 2-[[[1-(7-chloro-4-quinolinyl)-5-(2,6-dimethoxyphenyl)-3-pyrazolyl]-oxomethyl]amino]-2-adamantanecarboxylic acid (CHEBI:125516) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| meclinertant | WHO MedNet |
| Synonyms | Source |
|---|---|
| reminertant | ChEMBL |
| Reminertant | ChEMBL |
| Sr48692 | ChEMBL |
| SR-48692 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-37025 | LINCS |
| Citations |
|---|