EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O5 |
| Net Charge | 0 |
| Average Mass | 300.310 |
| Monoisotopic Mass | 300.09977 |
| SMILES | COc1cc(CC(=O)C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C17H16O5/c1-21-16-10-13(9-14(18)17(19)20)7-8-15(16)22-11-12-5-3-2-4-6-12/h2-8,10H,9,11H2,1H3,(H,19,20) |
| InChIKey | SFMKYOIUXKXHGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-methoxy-4-phenylmethoxyphenyl)-2-oxopropanoic acid (CHEBI:125489) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(3-methoxy-4-phenylmethoxyphenyl)-2-oxopropanoic acid (CHEBI:125489) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36989 | LINCS |