EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O4 |
| Net Charge | 0 |
| Average Mass | 198.178 |
| Monoisotopic Mass | 198.06406 |
| SMILES | NCCc1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O4/c9-2-1-5-3-7(11)8(12)4-6(5)10(13)14/h3-4,11-12H,1-2,9H2 |
| InChIKey | GAWRYVJRKWPEFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-aminoethyl)-5-nitrobenzene-1,2-diol (CHEBI:125478) is a catecholamine (CHEBI:33567) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36976 | LINCS |